C11H10N6O3 — CID 6850962
4-amino-N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 6850962) has the molecular formula C11H10N6O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-amino-N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 6850962 |
| Molecular Formula | C11H10N6O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-amino-N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NC(=N/N=C\c1ccc2c(c1)OCO2)c1nonc1N |
| InChI | InChI=1S/C11H10N6O3/c12-10(9-11(13)17-20-16-9)15-14-4-6-1-2-7-8(3-6)19-5-18-7/h1-4H,5H2,(H2,12,15)(H2,13,17)/b14-4- |
| InChIKey | YSAZIPKYNXBRRQ-CPSFFCFKSA-N |
| XLogP | 0.12 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|