C17H14N6O3 — CID 18531172
N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-4-hydroxy-3-iminoquinoxaline-2-carboximidamide (PubChem CID 18531172) has the molecular formula C17H14N6O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-4-hydroxy-3-iminoquinoxaline-2-carboximidamide.
| Compound Name | N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-4-hydroxy-3-iminoquinoxaline-2-carboximidamide |
|---|---|
| PubChem CID | 18531172 |
| Molecular Formula | C17H14N6O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-4-hydroxy-3-iminoquinoxaline-2-carboximidamide |
| SMILES | [H]/N=c1/c(/C(N)=N\N=C\c2ccc3c(c2)OCO3)nc2ccccc2n1O |
| InChI | InChI=1S/C17H14N6O3/c18-16(15-17(19)23(24)12-4-2-1-3-11(12)21-15)22-20-8-10-5-6-13-14(7-10)26-9-25-13/h1-8,19,24H,9H2,(H2,18,22)/b19-17-,20-8+ |
| InChIKey | LMIZZTOSODYAAY-HPZLHHMCSA-N |
| XLogP | 1.22 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|