C17H15N5O3 — CID 5397362
(2S)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(benzotriazol-1-yl)propanamide (PubChem CID 5397362) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2S)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(benzotriazol-1-yl)propanamide.
| Compound Name | (2S)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(benzotriazol-1-yl)propanamide |
|---|---|
| PubChem CID | 5397362 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (2S)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(benzotriazol-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)N/N=C\c1ccc2c(c1)OCO2)n1nnc2ccccc21 |
| InChI | InChI=1S/C17H15N5O3/c1-11(22-14-5-3-2-4-13(14)19-21-22)17(23)20-18-9-12-6-7-15-16(8-12)25-10-24-15/h2-9,11H,10H2,1H3,(H,20,23)/b18-9-/t11-/m0/s1 |
| InChIKey | WXCWKXTURYLPGR-HCGGYXKBSA-N |
| XLogP | 1.87 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|