C16H14FN5O — CID 5397368
(2S)-2-(benzotriazol-1-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide (PubChem CID 5397368) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is (2S)-2-(benzotriazol-1-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(benzotriazol-1-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 5397368 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2S)-2-(benzotriazol-1-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide |
| SMILES | C[C@@H](C(=O)N/N=C\c1ccccc1F)n1nnc2ccccc21 |
| InChI | InChI=1S/C16H14FN5O/c1-11(22-15-9-5-4-8-14(15)19-21-22)16(23)20-18-10-12-6-2-3-7-13(12)17/h2-11H,1H3,(H,20,23)/b18-10-/t11-/m0/s1 |
| InChIKey | LMNXQVVWVINWAW-TZQXVGBESA-N |
| XLogP | 2.28 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|