C23H20ClN5O2 — CID 92849204
(2S)-2-(benzotriazol-1-yl)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]propanamide (PubChem CID 92849204) has the molecular formula C23H20ClN5O2 and a molecular weight of 433.90 g/mol. Its IUPAC name is (2S)-2-(benzotriazol-1-yl)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]propanamide.
| Compound Name | (2S)-2-(benzotriazol-1-yl)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 92849204 |
| Molecular Formula | C23H20ClN5O2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (2S)-2-(benzotriazol-1-yl)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]propanamide |
| SMILES | C[C@@H](C(=O)N/N=C\c1ccccc1OCc1ccc(Cl)cc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C23H20ClN5O2/c1-16(29-21-8-4-3-7-20(21)26-28-29)23(30)27-25-14-18-6-2-5-9-22(18)31-15-17-10-12-19(24)13-11-17/h2-14,16H,15H2,1H3,(H,27,30)/b25-14-/t16-/m0/s1 |
| InChIKey | VNNLWJGATJLDQE-FTWDSPQQSA-N |
| XLogP | 4.38 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|