C9H8N4O4 — CID 51427314
1-(1,3-benzodioxol-5-ylmethylidene)-2-nitroguanidine (PubChem CID 51427314) has the molecular formula C9H8N4O4 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethylidene)-2-nitroguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethylidene)-2-nitroguanidine |
|---|---|
| PubChem CID | 51427314 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethylidene)-2-nitroguanidine |
| SMILES | N/C(N=Cc1ccc2c(c1)OCO2)=N\[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N4O4/c10-9(12-13(14)15)11-4-6-1-2-7-8(3-6)17-5-16-7/h1-4H,5H2,(H2,10,12) |
| InChIKey | DSDPCDQFAIZYSA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 112.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|