C15H13NO4S — CID 134998059
(NZ)-N-(1,3-benzodioxol-5-ylmethylidene)-4-methylbenzenesulfonamide (PubChem CID 134998059) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is (NZ)-N-(1,3-benzodioxol-5-ylmethylidene)-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-(1,3-benzodioxol-5-ylmethylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134998059 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (NZ)-N-(1,3-benzodioxol-5-ylmethylidene)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C\c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H13NO4S/c1-11-2-5-13(6-3-11)21(17,18)16-9-12-4-7-14-15(8-12)20-10-19-14/h2-9H,10H2,1H3/b16-9- |
| InChIKey | FAAORLFQSDBSJE-SXGWCWSVSA-N |
| XLogP | 2.53 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|