C16H18N4O6S — CID 135571166
1,1-diamino-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]methanimine oxide;4-methylbenzenesulfonic acid (PubChem CID 135571166) has the molecular formula C16H18N4O6S and a molecular weight of 394.41 g/mol. Its IUPAC name is 1,1-diamino-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]methanimine oxide;4-methylbenzenesulfonic acid.
| Compound Name | 1,1-diamino-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]methanimine oxide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 135571166 |
| Molecular Formula | C16H18N4O6S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1,1-diamino-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]methanimine oxide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(N)=[N+]([O-])/N=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H10N4O3.C7H8O3S/c10-9(11)13(14)12-4-6-1-2-7-8(3-6)16-5-15-7;1-6-2-4-7(5-3-6)11(8,9)10/h1-4H,5,10-11H2;2-5H,1H3,(H,8,9,10)/b12-4+; |
| InChIKey | CEQWRLPZWFFYMH-AQCBZIOHSA-N |
| XLogP | 0.77 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|