C9H9NO3 — CID 12062652
1-(1,3-benzodioxol-5-yl)-N-methylmethanimine oxide (PubChem CID 12062652) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-methylmethanimine oxide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-methylmethanimine oxide |
|---|---|
| PubChem CID | 12062652 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-methylmethanimine oxide |
| SMILES | C/[N+]([O-])=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9NO3/c1-10(11)5-7-2-3-8-9(4-7)13-6-12-8/h2-5H,6H2,1H3/b10-5+ |
| InChIKey | QJLNAJPMGGSMKJ-BJMVGYQFSA-N |
| XLogP | 0.97 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|