C17H16ClNO3 — CID 24799070
1-(1,3-benzodioxol-5-yl)-N-[1-(2-chlorophenyl)propan-2-yl]methanimine oxide (PubChem CID 24799070) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[1-(2-chlorophenyl)propan-2-yl]methanimine oxide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[1-(2-chlorophenyl)propan-2-yl]methanimine oxide |
|---|---|
| PubChem CID | 24799070 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[1-(2-chlorophenyl)propan-2-yl]methanimine oxide |
| SMILES | CC(Cc1ccccc1Cl)/[N+]([O-])=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16ClNO3/c1-12(8-14-4-2-3-5-15(14)18)19(20)10-13-6-7-16-17(9-13)22-11-21-16/h2-7,9-10,12H,8,11H2,1H3/b19-10+ |
| InChIKey | SZCLAQNVYFPKCK-VXLYETTFSA-N |
| XLogP | 3.63 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|