C17H19NO2S — CID 86015739
4-methyl-N-[(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide (PubChem CID 86015739) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-methyl-N-[(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 86015739 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-methyl-N-[(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=Cc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C17H19NO2S/c1-12-5-7-16(8-6-12)21(19,20)18-11-17-14(3)9-13(2)10-15(17)4/h5-11H,1-4H3 |
| InChIKey | VHOWEUOANNIGOA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|