C14H11F2NO2S — CID 71417577
N-[(2,3-difluorophenyl)methylidene]-4-methylbenzenesulfonamide (PubChem CID 71417577) has the molecular formula C14H11F2NO2S and a molecular weight of 295.31 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2,3-difluorophenyl)methylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71417577 |
| Molecular Formula | C14H11F2NO2S |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-[(2,3-difluorophenyl)methylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=Cc2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C14H11F2NO2S/c1-10-5-7-12(8-6-10)20(18,19)17-9-11-3-2-4-13(15)14(11)16/h2-9H,1H3 |
| InChIKey | AARSYCMQVQVYNE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|