C22H21NO3S — CID 110518890
(NZ)-4-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]benzenesulfonamide (PubChem CID 110518890) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is (NZ)-4-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]benzenesulfonamide.
| Compound Name | (NZ)-4-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 110518890 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (NZ)-4-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]benzenesulfonamide |
| SMILES | Cc1ccc(COc2ccccc2/C=N\S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-17-7-11-19(12-8-17)16-26-22-6-4-3-5-20(22)15-23-27(24,25)21-13-9-18(2)10-14-21/h3-15H,16H2,1-2H3/b23-15- |
| InChIKey | UNSKBRWFNCICHS-HAHDFKILSA-N |
| XLogP | 4.69 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|