C17H16N4O — CID 112537955
(Z)-1-[2-[(4-methylphenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 112537955) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is (Z)-1-[2-[(4-methylphenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[2-[(4-methylphenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 112537955 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (Z)-1-[2-[(4-methylphenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1ccc(COc2ccccc2/C=N\n2cnnc2)cc1 |
| InChI | InChI=1S/C17H16N4O/c1-14-6-8-15(9-7-14)11-22-17-5-3-2-4-16(17)10-20-21-12-18-19-13-21/h2-10,12-13H,11H2,1H3/b20-10- |
| InChIKey | WYHQGHUTONDSNB-JMIUGGIZSA-N |
| XLogP | 3.05 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|