C11H9N4O3- — CID 4109780
2-[2-(1,2,4-triazol-4-yliminomethyl)phenoxy]acetate (PubChem CID 4109780) has the molecular formula C11H9N4O3- and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-[2-(1,2,4-triazol-4-yliminomethyl)phenoxy]acetate.
| Compound Name | 2-[2-(1,2,4-triazol-4-yliminomethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 4109780 |
| Molecular Formula | C11H9N4O3- |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-[2-(1,2,4-triazol-4-yliminomethyl)phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1C=Nn1cnnc1 |
| InChI | InChI=1S/C11H10N4O3/c16-11(17)6-18-10-4-2-1-3-9(10)5-14-15-7-12-13-8-15/h1-5,7-8H,6H2,(H,16,17)/p-1 |
| InChIKey | YKAFQSJTOCVZAS-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|