C17H15ClN4OS — CID 3598940
1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 3598940) has the molecular formula C17H15ClN4OS and a molecular weight of 358.85 g/mol. Its IUPAC name is 1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 3598940 |
| Molecular Formula | C17H15ClN4OS |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Clc1ccc(SCCOc2ccccc2C=Nn2cnnc2)cc1 |
| InChI | InChI=1S/C17H15ClN4OS/c18-15-5-7-16(8-6-15)24-10-9-23-17-4-2-1-3-14(17)11-21-22-12-19-20-13-22/h1-8,11-13H,9-10H2 |
| InChIKey | MDOZEEWWLHMNDK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|