C20H21ClN4OS — CID 6892118
(E)-1-(2-butoxyphenyl)-N-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine (PubChem CID 6892118) has the molecular formula C20H21ClN4OS and a molecular weight of 400.94 g/mol. Its IUPAC name is (E)-1-(2-butoxyphenyl)-N-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine.
| Compound Name | (E)-1-(2-butoxyphenyl)-N-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 6892118 |
| Molecular Formula | C20H21ClN4OS |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (E)-1-(2-butoxyphenyl)-N-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine |
| SMILES | CCCCOc1ccccc1/C=N/n1cnnc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN4OS/c1-2-3-12-26-19-7-5-4-6-17(19)13-23-25-15-22-24-20(25)27-14-16-8-10-18(21)11-9-16/h4-11,13,15H,2-3,12,14H2,1H3/b23-13+ |
| InChIKey | XVNIMTJMPDZUST-YDZHTSKRSA-N |
| XLogP | 5.28 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|