C20H15ClN4OS — CID 136732639
1-[(Z)-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]naphthalen-2-ol (PubChem CID 136732639) has the molecular formula C20H15ClN4OS and a molecular weight of 394.89 g/mol. Its IUPAC name is 1-[(Z)-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(Z)-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136732639 |
| Molecular Formula | C20H15ClN4OS |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[(Z)-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N\n1cnnc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN4OS/c21-16-8-5-14(6-9-16)12-27-20-24-22-13-25(20)23-11-18-17-4-2-1-3-15(17)7-10-19(18)26/h1-11,13,26H,12H2/b23-11- |
| InChIKey | GAFCYYUDLJYQAX-KSEXSDGBSA-N |
| XLogP | 4.96 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|