C23H19ClN4OS — CID 20998661
(E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[4-[(4-chlorophenyl)methoxy]phenyl]methanimine (PubChem CID 20998661) has the molecular formula C23H19ClN4OS and a molecular weight of 434.95 g/mol. Its IUPAC name is (E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[4-[(4-chlorophenyl)methoxy]phenyl]methanimine.
| Compound Name | (E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[4-[(4-chlorophenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 20998661 |
| Molecular Formula | C23H19ClN4OS |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[4-[(4-chlorophenyl)methoxy]phenyl]methanimine |
| SMILES | Clc1ccc(COc2ccc(/C=N/n3cnnc3SCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H19ClN4OS/c24-21-10-6-19(7-11-21)15-29-22-12-8-18(9-13-22)14-26-28-17-25-27-23(28)30-16-20-4-2-1-3-5-20/h1-14,17H,15-16H2/b26-14+ |
| InChIKey | LKBJPRLMLKXTNR-VULFUBBASA-N |
| XLogP | 5.68 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|