C25H24N4O2S — CID 22693936
(E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-ethoxy-4-phenylmethoxyphenyl)methanimine (PubChem CID 22693936) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is (E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-ethoxy-4-phenylmethoxyphenyl)methanimine.
| Compound Name | (E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-ethoxy-4-phenylmethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 22693936 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (E)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-ethoxy-4-phenylmethoxyphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/n2cnnc2SCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H24N4O2S/c1-2-30-24-15-22(13-14-23(24)31-17-20-9-5-3-6-10-20)16-27-29-19-26-28-25(29)32-18-21-11-7-4-8-12-21/h3-16,19H,2,17-18H2,1H3/b27-16+ |
| InChIKey | CWYGGVVOXBCACQ-JVWAILMASA-N |
| XLogP | 5.43 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|