C19H20N3O3- — CID 6862254
2-[2-[(E)-(4-phenylpiperazin-1-yl)iminomethyl]phenoxy]acetate (PubChem CID 6862254) has the molecular formula C19H20N3O3- and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-[2-[(E)-(4-phenylpiperazin-1-yl)iminomethyl]phenoxy]acetate.
| Compound Name | 2-[2-[(E)-(4-phenylpiperazin-1-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6862254 |
| Molecular Formula | C19H20N3O3- |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[2-[(E)-(4-phenylpiperazin-1-yl)iminomethyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1/C=N/N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N3O3/c23-19(24)15-25-18-9-5-4-6-16(18)14-20-22-12-10-21(11-13-22)17-7-2-1-3-8-17/h1-9,14H,10-13,15H2,(H,23,24)/p-1/b20-14+ |
| InChIKey | VIMBCXLYHLIYQE-XSFVSMFZSA-M |
| XLogP | 0.97 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|