C16H11BrN4O2 — CID 1219958
[2-(1,2,4-triazol-4-yliminomethyl)phenyl] 2-bromobenzoate (PubChem CID 1219958) has the molecular formula C16H11BrN4O2 and a molecular weight of 371.19 g/mol. Its IUPAC name is [2-(1,2,4-triazol-4-yliminomethyl)phenyl] 2-bromobenzoate.
| Compound Name | [2-(1,2,4-triazol-4-yliminomethyl)phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 1219958 |
| Molecular Formula | C16H11BrN4O2 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | [2-(1,2,4-triazol-4-yliminomethyl)phenyl] 2-bromobenzoate |
| SMILES | O=C(Oc1ccccc1C=Nn1cnnc1)c1ccccc1Br |
| InChI | InChI=1S/C16H11BrN4O2/c17-14-7-3-2-6-13(14)16(22)23-15-8-4-1-5-12(15)9-20-21-10-18-19-11-21/h1-11H |
| InChIKey | KFHIPUAGAWUICQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|