C18H13F2NO2S2 — CID 170338972
N-[[4-(2,4-difluorophenyl)thiophen-2-yl]methylidene]-4-methylbenzenesulfonamide (PubChem CID 170338972) has the molecular formula C18H13F2NO2S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[[4-(2,4-difluorophenyl)thiophen-2-yl]methylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[4-(2,4-difluorophenyl)thiophen-2-yl]methylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 170338972 |
| Molecular Formula | C18H13F2NO2S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[[4-(2,4-difluorophenyl)thiophen-2-yl]methylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=Cc2cc(-c3ccc(F)cc3F)cs2)cc1 |
| InChI | InChI=1S/C18H13F2NO2S2/c1-12-2-5-16(6-3-12)25(22,23)21-10-15-8-13(11-24-15)17-7-4-14(19)9-18(17)20/h2-11H,1H3 |
| InChIKey | RJFJNMNYAPYGCG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|