C17H22O2 — CID 160857167
methane;5-methyl-1,3-benzodioxole;1,4-xylene (PubChem CID 160857167) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is methane;5-methyl-1,3-benzodioxole;1,4-xylene.
| Compound Name | methane;5-methyl-1,3-benzodioxole;1,4-xylene |
|---|---|
| PubChem CID | 160857167 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | methane;5-methyl-1,3-benzodioxole;1,4-xylene |
| SMILES | C.Cc1ccc(C)cc1.Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H8O2.C8H10.CH4/c1-6-2-3-7-8(4-6)10-5-9-7;1-7-3-5-8(2)6-4-7;/h2-4H,5H2,1H3;3-6H,1-2H3;1H4 |
| InChIKey | SJZWDBYXWSFFMJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |