C18H14O4 — CID 142656691
3-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)-2H-furan-5-one (PubChem CID 142656691) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)-2H-furan-5-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 142656691 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)-2H-furan-5-one |
| SMILES | Cc1ccc(C2=C(c3ccc4c(c3)OCO4)COC2=O)cc1 |
| InChI | InChI=1S/C18H14O4/c1-11-2-4-12(5-3-11)17-14(9-20-18(17)19)13-6-7-15-16(8-13)22-10-21-15/h2-8H,9-10H2,1H3 |
| InChIKey | HHPPIKWKAUGSPJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|