C14H19N7O — CID 6036961
4-amino-N'-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 6036961) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-amino-N'-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 6036961 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-amino-N'-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCN(CC)c1ccc(/C=N\N=C(\N)c2nonc2N)cc1 |
| InChI | InChI=1S/C14H19N7O/c1-3-21(4-2)11-7-5-10(6-8-11)9-17-18-13(15)12-14(16)20-22-19-12/h5-9H,3-4H2,1-2H3,(H2,15,18)(H2,16,20)/b17-9- |
| InChIKey | YRNGGGVUITZXDZ-MFOYZWKCSA-N |
| XLogP | 1.24 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|