C18H15Cl3N6O3 — CID 3379903
4-amino-N'-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 3379903) has the molecular formula C18H15Cl3N6O3 and a molecular weight of 469.72 g/mol. Its IUPAC name is 4-amino-N'-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 3379903 |
| Molecular Formula | C18H15Cl3N6O3 |
| Molecular Weight | 469.72 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | 4-amino-N'-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COc1ccc(C=NN=C(N)c2nonc2N)cc1COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3N6O3/c1-28-14-3-2-9(7-24-25-17(22)15-18(23)27-30-26-15)4-10(14)8-29-16-12(20)5-11(19)6-13(16)21/h2-7H,8H2,1H3,(H2,22,25)(H2,23,27) |
| InChIKey | AHPUNHOCEPCJQE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.72 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|