C25H22N2O4 — CID 11418546
9H-fluoren-9-ylmethyl N-[2-(1,3-benzodioxol-5-ylmethylideneamino)ethyl]carbamate (PubChem CID 11418546) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-(1,3-benzodioxol-5-ylmethylideneamino)ethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-(1,3-benzodioxol-5-ylmethylideneamino)ethyl]carbamate |
|---|---|
| PubChem CID | 11418546 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-(1,3-benzodioxol-5-ylmethylideneamino)ethyl]carbamate |
| SMILES | O=C(NCC/N=C/c1ccc2c(c1)OCO2)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22N2O4/c28-25(27-12-11-26-14-17-9-10-23-24(13-17)31-16-30-23)29-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,13-14,22H,11-12,15-16H2,(H,27,28)/b26-14+ |
| InChIKey | ZSVNEMVLHZNXIW-VULFUBBASA-N |
| XLogP | 4.37 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|