C17H13N3O3 — CID 17368285
(3E)-3-[(E)-1,3-benzodioxol-5-ylmethylidenehydrazinylidene]-1-methylindol-2-one (PubChem CID 17368285) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is (3E)-3-[(E)-1,3-benzodioxol-5-ylmethylidenehydrazinylidene]-1-methylindol-2-one.
| Compound Name | (3E)-3-[(E)-1,3-benzodioxol-5-ylmethylidenehydrazinylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 17368285 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (3E)-3-[(E)-1,3-benzodioxol-5-ylmethylidenehydrazinylidene]-1-methylindol-2-one |
| SMILES | CN1C(=O)/C(=N/N=C/c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C17H13N3O3/c1-20-13-5-3-2-4-12(13)16(17(20)21)19-18-9-11-6-7-14-15(8-11)23-10-22-14/h2-9H,10H2,1H3/b18-9+,19-16+ |
| InChIKey | XGVUPAGHMKLMMB-LBFRFMMHSA-N |
| XLogP | 2.21 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|