C12H16O6 — CID 102426655
2-[(4R,5R)-4,5-bis(methoxycarbonyl)cyclohexen-1-yl]acetic acid (PubChem CID 102426655) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-[(4R,5R)-4,5-bis(methoxycarbonyl)cyclohexen-1-yl]acetic acid.
| Compound Name | 2-[(4R,5R)-4,5-bis(methoxycarbonyl)cyclohexen-1-yl]acetic acid |
|---|---|
| PubChem CID | 102426655 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-[(4R,5R)-4,5-bis(methoxycarbonyl)cyclohexen-1-yl]acetic acid |
| SMILES | COC(=O)[C@@H]1CC=C(CC(=O)O)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C12H16O6/c1-17-11(15)8-4-3-7(6-10(13)14)5-9(8)12(16)18-2/h3,8-9H,4-6H2,1-2H3,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | VGPQHOFTAODCRL-RKDXNWHRSA-N |
| XLogP | 0.76 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|