C16H24O4 — CID 22212401
diethyl (1S,2S)-4-(2-methylprop-2-enyl)cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 22212401) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is diethyl (1S,2S)-4-(2-methylprop-2-enyl)cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | diethyl (1S,2S)-4-(2-methylprop-2-enyl)cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22212401 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | diethyl (1S,2S)-4-(2-methylprop-2-enyl)cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | C=C(C)CC1=CC[C@H](C(=O)OCC)[C@@H](C(=O)OCC)C1 |
| InChI | InChI=1S/C16H24O4/c1-5-19-15(17)13-8-7-12(9-11(3)4)10-14(13)16(18)20-6-2/h7,13-14H,3,5-6,8-10H2,1-2,4H3/t13-,14-/m0/s1 |
| InChIKey | QNLNNPKVFCVAKF-KBPBESRZSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|