diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate

C14H22O4 — CID 66938526

IUPACdiethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate
SMILESCCOC(=O)C1CC=C(C)C(C)C1C(=O)OCC
InChIInChI=1S/C14H22O4/c1-5-17-13(15)11-8-7-9(3)10(4)12(11)14(16)18-6-2/h7,10-12H,5-6,8H2,1-4H3
InChIKeyCUFDJXLMXWCKKQ-UHFFFAOYSA-N
MW254.33 g/mol
LogP2.33
Rot. Bonds4

About diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate

diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 66938526) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate.

Molecular Properties

Compound Namediethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate
PubChem CID66938526
Molecular FormulaC14H22O4
Molecular Weight254.33 g/mol
Exact Mass254.15
IUPAC Namediethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate
SMILESCCOC(=O)C1CC=C(C)C(C)C1C(=O)OCC
InChIInChI=1S/C14H22O4/c1-5-17-13(15)11-8-7-9(3)10(4)12(11)14(16)18-6-2/h7,10-12H,5-6,8H2,1-4H3
InChIKeyCUFDJXLMXWCKKQ-UHFFFAOYSA-N
XLogP2.33
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.33
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate?
The IUPAC name of diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate (CID 66938526) is diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate.
What is the SMILES notation for diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate?
The canonical SMILES for diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate is CCOC(=O)C1CC=C(C)C(C)C1C(=O)OCC.
What is the InChIKey of diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate?
The InChIKey is CUFDJXLMXWCKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-5-17-13(15)11-8-7-9(3)10(4)12(11)14(16)18-6-2/h7,10-12H,5-6,8H2,1-4H3.
What are the key properties of diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate?
diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate has a molecular weight of 254.33 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3,4-dimethylcyclohex-4-ene-1,2-dicarboxylate is sourced from PubChem (CID 66938526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).