C22H32O8 — CID 158393327
diethyl 3-methylcyclohex-4-ene-1,2-dicarboxylate;4-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 158393327) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is diethyl 3-methylcyclohex-4-ene-1,2-dicarboxylate;4-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | diethyl 3-methylcyclohex-4-ene-1,2-dicarboxylate;4-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 158393327 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | diethyl 3-methylcyclohex-4-ene-1,2-dicarboxylate;4-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1=CCC(C(=O)O)CC1C(=O)O.CCOC(=O)C1CC=CC(C)C1C(=O)OCC |
| InChI | InChI=1S/C13H20O4.C9H12O4/c1-4-16-12(14)10-8-6-7-9(3)11(10)13(15)17-5-2;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h6-7,9-11H,4-5,8H2,1-3H3;2,6-7H,3-4H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | GXFUYYQTGWIZCQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|