C13H14O4 — CID 101070997
trans-2-O-ethyl 1-O-phenyl (1R,2R)-cyclopropane-1,2-dicarboxylate (PubChem CID 101070997) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is trans-2-O-ethyl 1-O-phenyl (1R,2R)-cyclopropane-1,2-dicarboxylate.
| Compound Name | trans-2-O-ethyl 1-O-phenyl (1R,2R)-cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101070997 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | trans-2-O-ethyl 1-O-phenyl (1R,2R)-cyclopropane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H14O4/c1-2-16-12(14)10-8-11(10)13(15)17-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | NWAGFXZGZAKRGT-GHMZBOCLSA-N |
| XLogP | 1.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|