C12H14O3 — CID 134969081
cis-ethyl (1S,2R)-2-phenoxycyclopropane-1-carboxylate (PubChem CID 134969081) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-phenoxycyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2R)-2-phenoxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134969081 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | cis-ethyl (1S,2R)-2-phenoxycyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-2-14-12(13)10-8-11(10)15-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | BASDBLJCLDUECB-WDEREUQCSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |