C20H20O4 — CID 15685593
trans-diphenyl (1R,2R)-cyclohexane-1,2-dicarboxylate (PubChem CID 15685593) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is trans-diphenyl (1R,2R)-cyclohexane-1,2-dicarboxylate.
| Compound Name | trans-diphenyl (1R,2R)-cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15685593 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | trans-diphenyl (1R,2R)-cyclohexane-1,2-dicarboxylate |
| SMILES | O=C(Oc1ccccc1)[C@@H]1CCCC[C@H]1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H20O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-6,9-12,17-18H,7-8,13-14H2/t17-,18-/m1/s1 |
| InChIKey | UWCBUHNOZSDFEU-QZTJIDSGSA-N |
| XLogP | 4.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|