C28H24O4 — CID 101049037
trans-dinaphthalen-2-yl (1R,2R)-cyclohexane-1,2-dicarboxylate (PubChem CID 101049037) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is trans-dinaphthalen-2-yl (1R,2R)-cyclohexane-1,2-dicarboxylate.
| Compound Name | trans-dinaphthalen-2-yl (1R,2R)-cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101049037 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | trans-dinaphthalen-2-yl (1R,2R)-cyclohexane-1,2-dicarboxylate |
| SMILES | O=C(Oc1ccc2ccccc2c1)[C@@H]1CCCC[C@H]1C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H24O4/c29-27(31-23-15-13-19-7-1-3-9-21(19)17-23)25-11-5-6-12-26(25)28(30)32-24-16-14-20-8-2-4-10-22(20)18-24/h1-4,7-10,13-18,25-26H,5-6,11-12H2/t25-,26-/m1/s1 |
| InChIKey | GEXPGXRPPSYFCJ-CLJLJLNGSA-N |
| XLogP | 6.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|