C19H14O4 — CID 7926832
naphthalen-2-yl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 7926832) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is naphthalen-2-yl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | naphthalen-2-yl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 7926832 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | naphthalen-2-yl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | O=C(Oc1ccc2ccccc2c1)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C19H14O4/c20-19(18-12-21-16-7-3-4-8-17(16)23-18)22-15-10-9-13-5-1-2-6-14(13)11-15/h1-11,18H,12H2/t18-/m0/s1 |
| InChIKey | GCSPNODAFRDKQN-SFHVURJKSA-N |
| XLogP | 3.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|