C17H14N2O4 — CID 90538204
(1-methylbenzimidazol-5-yl) 2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 90538204) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is (1-methylbenzimidazol-5-yl) 2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | (1-methylbenzimidazol-5-yl) 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 90538204 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (1-methylbenzimidazol-5-yl) 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | Cn1cnc2cc(OC(=O)C3COc4ccccc4O3)ccc21 |
| InChI | InChI=1S/C17H14N2O4/c1-19-10-18-12-8-11(6-7-13(12)19)22-17(20)16-9-21-14-4-2-3-5-15(14)23-16/h2-8,10,16H,9H2,1H3 |
| InChIKey | YLYBHSYITWYAEL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|