C17H14O5 — CID 7741127
(4-acetylphenyl) (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 7741127) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is (4-acetylphenyl) (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | (4-acetylphenyl) (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 7741127 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (4-acetylphenyl) (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)[C@H]2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C17H14O5/c1-11(18)12-6-8-13(9-7-12)21-17(19)16-10-20-14-4-2-3-5-15(14)22-16/h2-9,16H,10H2,1H3/t16-/m1/s1 |
| InChIKey | KNHMPCVYTAOKDQ-MRXNPFEDSA-N |
| XLogP | 2.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|