C18H16O7 — CID 8840323
(2-methoxy-4-methoxycarbonylphenyl) (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 8840323) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is (2-methoxy-4-methoxycarbonylphenyl) (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | (2-methoxy-4-methoxycarbonylphenyl) (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 8840323 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (2-methoxy-4-methoxycarbonylphenyl) (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)[C@@H]2COc3ccccc3O2)c(OC)c1 |
| InChI | InChI=1S/C18H16O7/c1-21-15-9-11(17(19)22-2)7-8-14(15)25-18(20)16-10-23-12-5-3-4-6-13(12)24-16/h3-9,16H,10H2,1-2H3/t16-/m0/s1 |
| InChIKey | NXDSZOPJAKECHQ-INIZCTEOSA-N |
| XLogP | 2.23 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|