C23H20O4 — CID 2448069
[2-methyl-4-(4-methylphenyl)phenyl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 2448069) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-methyl-4-(4-methylphenyl)phenyl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | [2-methyl-4-(4-methylphenyl)phenyl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 2448069 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [2-methyl-4-(4-methylphenyl)phenyl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)[C@@H]3COc4ccccc4O3)c(C)c2)cc1 |
| InChI | InChI=1S/C23H20O4/c1-15-7-9-17(10-8-15)18-11-12-19(16(2)13-18)27-23(24)22-14-25-20-5-3-4-6-21(20)26-22/h3-13,22H,14H2,1-2H3/t22-/m0/s1 |
| InChIKey | AWNNMDORHINUSZ-QFIPXVFZSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|