C27H21NO7 — CID 19186650
[2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 19186650) has the molecular formula C27H21NO7 and a molecular weight of 471.47 g/mol. Its IUPAC name is [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 19186650 |
| Molecular Formula | C27H21NO7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | CC(NC(=O)c1cc2ccc(OC(=O)C3COc4ccccc4O3)cc2oc1=O)c1ccccc1 |
| InChI | InChI=1S/C27H21NO7/c1-16(17-7-3-2-4-8-17)28-25(29)20-13-18-11-12-19(14-23(18)35-26(20)30)33-27(31)24-15-32-21-9-5-6-10-22(21)34-24/h2-14,16,24H,15H2,1H3,(H,28,29) |
| InChIKey | FGRQQVUDPHGZJF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|