C24H26O4 — CID 153329333
diphenyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,4-dicarboxylate (PubChem CID 153329333) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is diphenyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,4-dicarboxylate.
| Compound Name | diphenyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 153329333 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | diphenyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccccc1)C1CCC(C(=O)Oc2ccccc2)C2CCCCC12 |
| InChI | InChI=1S/C24H26O4/c25-23(27-17-9-3-1-4-10-17)21-15-16-22(20-14-8-7-13-19(20)21)24(26)28-18-11-5-2-6-12-18/h1-6,9-12,19-22H,7-8,13-16H2 |
| InChIKey | CWKGASQGUANGAI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|