C16H19FO4 — CID 91727998
1-O-ethyl 2-O-(3-fluorophenyl) cyclohexane-1,2-dicarboxylate (PubChem CID 91727998) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-O-ethyl 2-O-(3-fluorophenyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-(3-fluorophenyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91727998 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-O-ethyl 2-O-(3-fluorophenyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CCCCC1C(=O)Oc1cccc(F)c1 |
| InChI | InChI=1S/C16H19FO4/c1-2-20-15(18)13-8-3-4-9-14(13)16(19)21-12-7-5-6-11(17)10-12/h5-7,10,13-14H,2-4,8-9H2,1H3 |
| InChIKey | CBUVXQYXBSAYEI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|