C19H26O4 — CID 91722244
2-O-(3,4-dimethylphenyl) 1-O-propyl cyclohexane-1,2-dicarboxylate (PubChem CID 91722244) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-O-(3,4-dimethylphenyl) 1-O-propyl cyclohexane-1,2-dicarboxylate.
| Compound Name | 2-O-(3,4-dimethylphenyl) 1-O-propyl cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91722244 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-O-(3,4-dimethylphenyl) 1-O-propyl cyclohexane-1,2-dicarboxylate |
| SMILES | CCCOC(=O)C1CCCCC1C(=O)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H26O4/c1-4-11-22-18(20)16-7-5-6-8-17(16)19(21)23-15-10-9-13(2)14(3)12-15/h9-10,12,16-17H,4-8,11H2,1-3H3 |
| InChIKey | OTGZJSQRJHFFGS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|