C17H25NO4S — CID 6471685
(3,4-dimethylphenyl) 1-propylsulfonylpiperidine-3-carboxylate (PubChem CID 6471685) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 1-propylsulfonylpiperidine-3-carboxylate.
| Compound Name | (3,4-dimethylphenyl) 1-propylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 6471685 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3,4-dimethylphenyl) 1-propylsulfonylpiperidine-3-carboxylate |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)Oc2ccc(C)c(C)c2)C1 |
| InChI | InChI=1S/C17H25NO4S/c1-4-10-23(20,21)18-9-5-6-15(12-18)17(19)22-16-8-7-13(2)14(3)11-16/h7-8,11,15H,4-6,9-10,12H2,1-3H3 |
| InChIKey | YNRSQQHQUBCHNR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|