About 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane
1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane (PubChem CID 110799671) has the molecular formula C16H26N2O4S2
and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane |
| PubChem CID | 110799671 |
| Molecular Formula | C16H26N2O4S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane |
| SMILES | CCCS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C16H26N2O4S2/c1-4-12-23(19,20)17-8-5-9-18(11-10-17)24(21,22)16-7-6-14(2)15(3)13-16/h6-7,13H,4-5,8-12H2,1-3H3 |
| InChIKey | RXBGPWYIATULKT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane?
The IUPAC name of 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane (CID 110799671) is 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane.
What is the SMILES notation for 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane?
The canonical SMILES for 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane is CCCS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1.
What is the InChIKey of 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane?
The InChIKey is RXBGPWYIATULKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O4S2/c1-4-12-23(19,20)17-8-5-9-18(11-10-17)24(21,22)16-7-6-14(2)15(3)13-16/h6-7,13H,4-5,8-12H2,1-3H3.
What are the key properties of 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane?
1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane has a molecular weight of 374.53 g/mol, XLogP of 1.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenyl)sulfonyl-4-propylsulfonyl-1,4-diazepane is sourced from PubChem (CID 110799671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).