C13H20O4 — CID 564350
diethyl 4-methylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 564350) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is diethyl 4-methylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | diethyl 4-methylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 564350 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | diethyl 4-methylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC=C(C)CC1C(=O)OCC |
| InChI | InChI=1S/C13H20O4/c1-4-16-12(14)10-7-6-9(3)8-11(10)13(15)17-5-2/h6,10-11H,4-5,7-8H2,1-3H3 |
| InChIKey | UCFKSYIZKWYRTR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|