C16H22N2O3 — CID 164669727
ethyl (1S,6S)-6-(3,5-dimethylpyrazole-1-carbonyl)-3-methylcyclohex-3-ene-1-carboxylate (PubChem CID 164669727) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl (1S,6S)-6-(3,5-dimethylpyrazole-1-carbonyl)-3-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6S)-6-(3,5-dimethylpyrazole-1-carbonyl)-3-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 164669727 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethyl (1S,6S)-6-(3,5-dimethylpyrazole-1-carbonyl)-3-methylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(C)=CC[C@@H]1C(=O)n1nc(C)cc1C |
| InChI | InChI=1S/C16H22N2O3/c1-5-21-16(20)14-8-10(2)6-7-13(14)15(19)18-12(4)9-11(3)17-18/h6,9,13-14H,5,7-8H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | XAVGQMWNPBNDMR-KBPBESRZSA-N |
| XLogP | 2.68 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|